A wall map of the United States has a distance of 8.5 in. between Memphis and Denver, two cities that are actually 1040 mi apart. The actual distance between St. Louis and Des Moines is 333 mi. How far apart are St. Louis and Des Moines on the map?

Answers

Answer 1

Answer:

2.72 inches

Step-by-step explanation:

1040/8.5=122.35

1 inch on the map = 122.35 miles actual distance

333/122.35=2.72


Related Questions

Help please ….. help

Answers

Answer:

Step-by-step explanation:

a) categorical

b) add all of the numbers and divide by how many numbers there were.

c) outliers means any that were far away from the rest of the data

d) not entirely, you can make an estimate based on it, but nat an exact answer.

How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse

Answers

Answer:

isosceles acute

Step-by-step explanation:

We have two sides that are equal so the triangle is isosceles

None of the angles are larger than 90 degrees so non of the angles are obtuse,  and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)

Two chords in a circle intersect. One chord is made of 6 and 5, and the other is made of x +1 and x. What is x?

Answers

Answer:

x = 5 and -6

Step-by-step explanation:

Using the intersecting chord theorem which states that the products of the lengths of the line segments on each chord are equal.

Hence:

let

a = 6, b = 5, c = x+1 and d = x

Therefore, ab = cd

6*5 = x(x+1)

30 = x²+x

x²+x - 30 = 0

x²+ 6x - 5x - 30 = 0

x(x+6) - 5(x+6) =0

(x-5)(x+6) = 0

x-5 =0 and x+6 = 0

x = 5 and -6

What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?

Answers

Answer:

17 units

Step-by-step explanation:

Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

Plug in the points and simplify:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]

[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]

[tex]d = \sqrt{225 + 64[/tex]

[tex]d = \sqrt{289[/tex]

[tex]d = 17[/tex]

So, the distance between the points is 17 units

a coin is tossed succesively three times times . determine tje probabiliy of getting all three heads​

Answers

Answer:

Answer : 1/8.

Step-by-step explanation:

Hey there!

Please see the attached picture for your answer.

Hope it helps!

The function below models the correlation between the number of hours a plant is kept in sunlight (x) and the height (y), in mm, to which it grows: y = 2 + 4x What does the y-intercept of this function represent? (1 point) The original height of the plant was 4 mm. The original height of the plant was 2 mm. The height of the plant increases by 2 mm for every hour of sunlight it receives. The height of the plant increases by 4 mm for every hour of sunlight it receives.

Answers

Answer:

The original height of the plant was 2 mm

Step-by-step explanation:

Given

[tex]y = 2 + 4x[/tex]

Required

Interpret the y-intercept

The y-intercept is when [tex]x = 0[/tex]

So, we have:

[tex]y = 2 + 4 *0[/tex]

[tex]y = 2 + 0[/tex]

[tex]y = 2[/tex]

This implies that the original or initial height was 2 mm

.
.
.
.
.
.
.
.
.
.
.
“””” HELP PLEASE “”””
.
.
.
.
.
.
.
.
.
.
.

Answers

9514 1404 393

Answer:

  x = 14 cm

Step-by-step explanation:

We can only solve for x if the triangles are similar. The arrows on the left and right legs say those are parallel. Since alternate interior angles at each of the transversals are congruent, the triangles are AA similar.

ΔABC ~ ΔDEC, so we have ...

  EC/ED = BC/BA

  x/(18 cm) = (35 cm)/(45 cm)

  x = (18 cm)(7/9) = 14 cm

find the missing side length below brainly

Answers

Let it be x

[tex]\\ \sf\longmapsto \dfrac{3}{5}=\dfrac{x}{x+4}[/tex]

[tex]\\ \sf\longmapsto 3(x+4)=5x[/tex]

[tex]\\ \sf\longmapsto 3x+12=5x[/tex]

[tex]\\ \sf\longmapsto 5x-3x=12[/tex]

[tex]\\ \sf\longmapsto 2x=12[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{12}{2}[/tex]

[tex]\\ \sf\longmapsto x=6[/tex]

The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem

dN/dt = N(1 − 0.0008N), N(0) = 1.

Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?

Answers

Answer:

1250 supermarkets

Step-by-step explanation:

Given

[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]

[tex]N(0) = 1[/tex]

Required

Number of supermarkets over a long period of time

To do this, we simply set

[tex]\frac{dN}{dt} = 0[/tex]

So, we have:

[tex]N(1 - 0.0008N) = 0[/tex]

Split

[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]

Solve: [tex]1 - 0.0008N = 0[/tex]

Collect like terms

[tex]0.0008N = 1[/tex]

Make N the subject

[tex]N = \frac{1}{0.0008}[/tex]

[tex]N = 1250[/tex]

So:

[tex]\lim_{t \to \infty} N(t) = 1250[/tex]

Which of the following questions are equivalent to the answer below x 3/5

Answers

Answer:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex]

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex]

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex]

Step-by-step explanation:

Given

[tex]x^\frac{3}{5}[/tex]

Required

The equivalent expressions

We have:

[tex]x^\frac{3}{5}[/tex]

Expand the exponent

[tex]x^\frac{3}{5} = x^{ 3 * \frac{1}{5}}[/tex]

So, we have:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex] ----- this is equivalent

Express 1/5 as roots (law of indices)

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex] ------ this is equivalent

The above can be rewritten as:

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex] ------ this is equivalent


I need help answering this ASAP

Answers

Answer:

A

Step-by-step explanation:

The graph is a square root function

Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.

Answers

X - Y = 36 -> X = 36+ Y
3X + 2Y = 48 -> 3(36+Y)+2Y= 48-> Y = -12
X = 36-12= 24
X -2Y= 24-2.(-12) = 48

sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

What is the value of x in the equation 5(3x + 4) = 23?

Answers

Answer:

x = 1/5

Step-by-step explanation:

5(3x + 4) = 23

Distribute

15x+20 = 23

Subtract 20 from each side

15x+20-20 = 23-20

15x = 3

Divide by 15

15x/15 = 3/15

x = 1/5

Answer:

[tex]x = 0.2[/tex]

Step-by-step explanation:

Step 1:  Distribute

[tex]5(3x + 4) = 23[/tex]

[tex](5 * 3x) + (5 * 4) = 23[/tex]

[tex](15x) + 20 = 23[/tex]

Step 2:  Subtract 20 from both sides

[tex](15x) + 20 - 20 = 23 - 20[/tex]

[tex]15x = 3[/tex]

Step 3:  Divide both sides by 15

[tex]\frac{15x}{15} = \frac{3}{15}[/tex]

[tex]x = \frac{1}{5}[/tex]

[tex]x = 0.2[/tex]

Answer:  [tex]x = 0.2[/tex]

Assume a researcher wants to compare the mean Alanine Aminotransferase (ALT) levels in two populations, individuals who drink alcohol and individuals who do not drink alcohol. The mean ALT levels for the individuals who do not drink alcohol is 32 with a standard deviation of 14, and 37 individuals were in the sample. The mean ALT levels for individuals who drink alcohol is 69 with a standard deviation of 19, and 38 individuals were in the sample. Construct and interpret a 95% confidence interval demonstrating the difference in means for those individuals who drink alcohol when compared to those who do not drink alcohol.
a. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.22 and 39.78.
b. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.33 and 39.67
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
d. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.41 and 39.59.

Answers

Answer:

c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.

Step-by-step explanation:

Given :

Groups:

x1 = 69 ; s1 = 19 ; n1 = 38

x2 = 32 ; s2 = 14 ; n2 = 37

1 - α = 1 - 0.95 = 0.05

Using a confidence interval calculator to save computation time, kindly plug the values into the calculator :

The confidence interval obtained is :

(24.32 ; 39.68) ; This means that we are 95% confident that the true mean difference in ALT values between the two population lies between

(24.32 ; 39.68) .

1. You are given the 3rd and 5th term of an arithmetic sequence. Describe in words how to determine the general term.

2. You are given the 3rd and 5th term of an geometric sequence. Describe how to determine the 10th term without finding the general term.

Answers

Step-by-step explanation:

1. In an arithmetic sequence, the general term can be written as

xₙ = y + d(a-1), where xₐ represents the ath term, y is the first value, and d is the common difference.

Given the third term and the fifth term, and knowing that the difference between each term is d, we can say that the 4th term is x₃+d and the fifth term is the fourth term plus d, or (x₃+d)+d =

x₃+2d. =x₅ Given x₃ and x₅, we can subtract x₃ from both sides to get

x₅-x₃ = 2d

divide by 2 to isolate d

(x₅-x₃)/2 = d

This lets us solve for d. Given d, we can say that

x₃ = y+d(2)

subtract 2*d from both sides to isolate the y

x₃ -2*d = y

Therefore, because we know x₃ and d at this point, we can solve for y, letting us plug y and d into our original equation of

xₙ = y + d(a-1)

2.

Given the third and fifth term, with a common ratio of r, we can say that the fourth term is x₃ * r. Then, the fifth term is

x₃* r * r

= x₃*r² = x₅

divide both sides by x₃ to isolate the r²

x₅/x₃ = r²

square root both sides

√(x₅/x₃) = ±r

One thing that is important to note is that we don't know whether r is positive or negative. For example, if x₃ = 4 and x₅ = 16, regardless of whether r is equal to 2 or -2, 4*r² = 16. I will be assuming that r is positive for this question.

Given the common ratio, we can find x₆ as x₅ * r, x₇ as x₅*r², and all the way up to x₁₀ = x₅*r⁵. We don't know the general term, but can still find the tenth term of the sequence

You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.

Answers

Answer:

[tex]35.36,44.64[/tex]

Step-by-step explanation:

Sample size [tex]n=40[/tex]

Mean weight [tex]\=x =67[/tex]

Standard deviation [tex]\sigma=11.4[/tex]

Confidence Interval [tex]CI=0.99[/tex]

\alpha==0.01

Therefore

[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]

From table

[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]

Generally, the equation for Margin of error is mathematically given by

[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]

[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]

[tex]M.E=4.64[/tex]

Therefore Estimated mean is

[tex]\=x-M.E<\mu <\=x +E[/tex]

[tex]40-4.64<\mu< 40+4.64[/tex]

[tex]35.36<\mu < 44.64[/tex]

[tex]35.36,44.64[/tex]

rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible​

Answers

= 2025

When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)

For this, you divide the given lengths using the numbers that divides all through.

I have added an image to this answer. Go through it for more explanation

18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?

acute

obtuse

equiangular

right

Answers

Answer:

obtuse                    

aniuhafjhnfajfnha

0.5 kilograms (kg) is equal to how many ounces? Round your answer to the

Answers

Answer:

17.637 ounces

Step-by-step explanation:

35.274 ounces is 1 kilogram so divide 35.274 by 2

Might want to keep the other guy Brainly

GIVING 25 POINTS AND BRAINIER IF ANSWERED!

What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.

Answers

The answer to your question is A

Answer:

B. The question may not be directly stated.

Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later

Answers

Answer:

The rate at which the distance between the two cars is increasing is 30 mi/h

Step-by-step explanation:

Given;

speed of the first car, v₁ = 24 mi/h

speed of the second car, v₂ = 18 mi/h

Two hours later, the position of the cars is calculated as;

position of the first car, d₁ = 24 mi/h  x 2 h  = 48 mi

position of the second car, d₂ = 18 mi/h  x 2 h = 36 mi

The displacement of the two car is calculated as;

displacement, d² = 48² + 36²

                        d² = 3600

                        d = √3600

                        d = 60 mi

The rate at which this displacement is changing = (60 mi) / (2h)

                                                                                 = 30 mi/h

Help me! Thanks!!!!!!

Answers

Answer:

there are infinite solutions

Step-by-step explanation:

if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system

PLEASE HELP ASAP!!!!!

Answers

Step-by-step explanation:

Area ABC=1/2ab×sin C

=1/2 ×20×10 ×Sin C

Sin C =100

the camdens drove 116 miles on 5 gallons of gas. at this rate, how many miles can they drive on 7 gallons of gas

Answers

Answer:

162.4 miles

Step-by-step explanation:

We can write a ratio to solve

116 miles            x miles

----------------- = ------------

5 gallons           7 gallons

Using cross products

116*7 = 5x

Divide by 5

812 /5 = 5x/5

162.4 =x

162.4 miles

Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)

Answers

Answer:

The zeroes of the function are: 3 and 4

Step-by-step explanation:

Please send only answer
Want to bring a metal rod to assemble a toy frame. All long metal rods must be used at least. How much to assemble the frame as shown in the picture

Answers

Answer:

how many times should u use the metal rod ??

A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.

Answers

Answer:

C

Step-by-step explanation:

The diameter of a regulation soccer ball is about 8 and three-fifths inches. This number was graphed on a number line.

A number line going from negative 9 to positive 9. Point A is between negative 9 and negative 8, point B is between negative 7 and negative 6, point C is between 6 and 7, point D is between 8 and 9.

Which point could be the point representing the graph of the diameter of the ball?
A
B
C
D

Answers

Answer:

D

Step-by-step explanation:

8 and 3/5 = 8.2 and 8.2 is between 8 and 9 so the answer is D.

find the equation of straight line passes through point (3,1) such that the intercept on y-axis exceeds that on the x- axis by 4.



Answers

Answer:

Step-by-step explanation:

Other Questions
Find the volume of this sphere please help If 5k = -25, then 5k - 1 = -25 - 1Segment proof The relation between quality & the human resource function The company currently has $10.035 billion in long-term debt; assume $9.5 billion is in bonds. The company wishes to refinance its $9.5 billion bonds; therefore, it will reissue bonds. The structure of the new bonds is as follows: Maturity = 35 years, Coupon Rate = 3.5%, and they have a face value of $1,000 each. Similar bonds in the market have a yield-to-maturity (YTM) of 2.75%. What is the price of each bond? Are they trading at a discount or premium? Help for number 2a) b) c) Thank you!! Make u the brainliest What is one thing people can do to prevent phosphorus pollution in bodies ofwater?A. Use less fertilizer.B. Burn more fossil fuels.C. Plant fewer trees.D. Buy more bottled water. In a parallelogram ABCD, prove that (AC)2 + (BD)2= 2[(AB)? +(BC)?]. que tienen en comn la materia y el sistema? Charlotte has to read a book for school. There are 513 pages in the book. She read 113 pages onSaturday, she read 78 pages on Sunday, and 101 pages on Monday. How many pages does Charlottehave left to read?A.221 pagesB.513 pagesC.292 pagesD.400 pages A Whopper combo meal costs $3.00 and gives you an additional 15 units of utility; a meal at the Embassy Suites costs $29.00 and gives you an additional 145 units of utility. Based solely on the information you have, using the theory of rational choice, you most likely would: Question 51.00 g of He, 14.0g F2, and 19.0 g Ar are placed in a 13.0-L container at 20.0 C. The total pressure (in atm) in the container is _____ atm.1 point A particle is moving such that its height h at time t is given by h(t) = 2 + 8t - 3t^2 + 1/5t^3. The average velocity of the particle on the period [0,3] is How do endophytes affect grazing animals?A. Endophytes pull nutrients from the soil, making plants more nutritious for grazing animals.B. Endophytes that produce toxins can be poisonous to grazing animals.C. Endophytes fix nitrogen from the air, making plants more nutritious for grazing animals.D. Endophytes are poisonous to plants, depriving grazing animals of forage. Identify the true statement. a. As the sea floor spreads, the lithosphere rises to fill the space between plates. b. Some magma generated during seafloor spreading erupts from submarine volcanoes. c. New oceanic crust is ultramafic in composition. d. Some magma generated during seafloor spreading spills out to produce a new layer of seafloor called gabbro. is (x-2) a factor of f(x) = x^3 2x^2 + 2x + 3, use either remainder theorem or factor theorem to explain your reasoning Please calculate GDP using the following information: Government purchases - $200 billion Depreciation - $60 billion Investment - $80 billion Consumption - $600 billion Exports - $100 billion Imports - $120 billion Income receipts from the rest of the world - $10 billion Income payments to the rest of the world - $8 billion How wide is the portion of Antarctica that belongs to Chile?half a thousand square milestwo million square milesone million squaremileshalf a milijon square milesThe answer is d Sally collected 22 pounds of cans to recycleand plans to collect 1.8 more pounds eachweek. In this situation, what is the value ofthe y-intercept? Translate this to english (btw its snapish to english)Eres precioso How many terms are in the following geometric sequence? Type your numerical answer only. Do not type any additional characters.0.0625, 0,25, 1, 4194304