How does production and possibilities curve show efficiency grouth and opportunity cost

Answers

Answer 1

Answer:

The Production Possibilities Curve (PPC) is a model that captures scarcity and the opportunity costs of choices when faced with the possibility of producing two goods or services. Points on the interior of the PPC are inefficient, points on the PPC are efficient, and points beyond the PPC are unattainable.

Explanation:


Related Questions

what is the definition for the term Resistance?​

Answers

Answer:

Hey mate....

Explanation:

This is ur answer.....

There are 2 definitions :-

The refusal to accept or comply with something.The ability not to be affected by something, especially adversely.

Hope it helps!

Brainliest pls!

Follow me! :)

is atmosphere pressure at high altitudes is less than the pressure at ground, true or false​

Answers

Answer:

The answer is true I guess!!!

This is because the more you go up to less air it is and the pressure also gets less!!!!!!!!

Explanation:

I HOPE THAT I WAS HELPFUL TO YOU!

A 1500 kg car travels 50 m north in 20 seconds. What is the magnitude of the average velocity of the car during the 20 second interval?
a. 2.5 m/s
b. 5.0 m/s
c. 6.5 m/s
d. 7.0 m/s

Answers

Answer:

a. 2.5 m/s

Explanation:

50 / 20 = 2.5 m/s

Describe when the chemical
reaction occurs in a dry-cell
battery

Answers

Answer:

For a dry-cell battery to operate, oxidation will occur from the zinc anode and reduction will take place in the cathode. The most common type of cathode is a carbon graphite. Once reactants have been turned into products, the dry-cell battery will work to produce electricity.

Explanation:

The battery operates through electrochemical reactions called oxidation and reduction. These reactions involve the exchange of electrons between chemical species. If a chemical species loses one or more electrons, this is called oxidation. The opposite process, the gain of electrons, is called reduction.

a 25 kg crate is pushed horizontally with a force of 70N. if the coefficient of friction is .20, calculate the acceleration of the crate.

Answers

From Newton's second law of motion, the acceleration of the crate is 0.84m/[tex]s^{2}[/tex]

Given that a 25 kg crate is pushed horizontally with a force of 70N and the coefficient of friction is 0.20

To calculate the acceleration of the crate, We will consider the net force acting on the crate. The net force will be sum of the applied force F and the frictional force [tex]F_{r}[/tex].

Let us first calculate the frictional force [tex]F_{r}[/tex]. That is,

[tex]F_{r}[/tex] =- μN

[tex]F_{r}[/tex] = μmg

[tex]F_{r}[/tex] = 0.2 x 25 x 9.8

[tex]F_{r}[/tex] = 49N

Using Newton's second law,

F = ma

F - [tex]F_{r}[/tex] = ma

70 - 49 =  25 a

21 = 25a

a = 21 / 25

a = 0.84 m/[tex]s^{2}[/tex]

Therefore, the acceleration of the crate is 0.84m/[tex]s^{2}[/tex]

Learn more here: https://brainly.com/question/1141170

A 30 g mass is attached to one end of a 10-cm-long spring.
The other end of the spring is connected to a frictionless pivot on
a frictionless, horizontal surface. Spinning the mass around in a
circle at 90 rpm causes the spring to stretch to a length of 12 cm.
What is the value of the spring constant?

Answers

The value of the spring constant of the spring is 14.7 N/m.

The given parameters;

mass attached to the spring, m = 30 glength of the spring, L₀ = 10 cmangular speed of the mass = 90 rpmfinal length of the spring, L₁ = 12 cm

The extension of the spring is calculated as follows;

[tex]\Delta x = L_1 - L_0\\\\\Delta x = 12 \ cm - \ 10 \ cm\\\\\Delta x = 2 \ cm = 0.02 \ m[/tex]

The value of the spring constant of the spring is calculated by applying Hooke's law;

[tex]F = mg = k\Delta x\\\\k = \frac{mg}{\Delta x } \\\\k = \frac{0.03 \times 9.8}{0.02} \\\\k = 14.7 \ N/m[/tex]

Learn more about Hooke's law here:https://brainly.com/question/4404276

What is the equivalent resistance of a 12-ohm resistor wired in parallel with a 4-ohm resistor?
А
0.06 ohms
B
0.33 ohms
С
3.0 ohms
D
16.0 ohms

Answers

[tex]R=\frac{R1.R2}{R1+R2} = \frac{12.4}{12+4}=\frac{48}{16}=3<ohms>[/tex]

The answer is : C. 3.0 ohms

Ok done. Thank to me :>

How does the temp of water change when it is heated on a stove top and it begins to boil.

Answers

Answer:

The temperature will no longer rise with the heat because the energy. When the water is boiled on the steam, the temperature rises when heat is given

Explanation:

what is momentum?
what is period of an oscillating body?
what is friction?

Answers

Answer:

Explanation:

Momentum is the quantity of motion of a moving body, measured as a product of its mass and velocity.

The period of an oscillating body is the smallest interval of time in which a system undergoing oscillation returns to the state it was in at a time arbitrarily chosen as the beginning of the oscillation.

Friction is a force between two surfaces that are sliding, or trying to slide, across each other.  Friction always slows a moving object down. The amount of friction depends on the materials from which the two surfaces are made. The rougher the surface, the more friction is produced.

How can you use a simple model to describe a wave and its features?

Answers

Answer:

Explanation:

Use mathematical representations to describe a simple model for waves that includes how the amplitude of a wave is related to the energy in a wave. Patterns can be used to identify cause and effect relationships.

Help pleaseeeeeeeeeeeeeee

Answers

Answer:

im not the best at this but im gonna try helping you

Explanation:

1. li est deux heures cinquante

2. il est huit heures et demie

3. il est douze heures

4. il est quatre heures cinq

5. il est quatre heures quarante cinq

Which liquid substance Would evaporate most quickly in the open air at 25 celius

Answers

Liquid helium has the lowest boiling point of all — about -452 degrees Fahrenheit

A block of mass M is attached to a spring of negligible mass and can slide on a horizontal surface along the x-direction, as shown above. There is friction present between the block and the surface. The spring exerts no force on the block when the center of the block is located at x=0. At the instant shown above, the block is located at x=0 and moving toward the right with speed v=v0. (a) For the instant shown above, with the block located at x=0 and moving to the right, predict the direction of the net force on the block. If the net force is zero, select “The net force is zero.”

_ To the left _ The net force is zero _ To the right
Briefly justify your prediction.

Answers

Answer:

Because of the frictional force, the net force will oppose direction of the block and be directed towards the left even tho the spring exerts no force at this point

A bicycle accelerates from rest to 6m/s in a distance of 50m, calculate the acceleration

Answers

50x6=300 this is the answer I think

The acceleration of the bicycle is 0.12 m/[tex]s^{2}[/tex].

We know that acceleration is the change in velocity divided by the change in time. In this case, the bicycle is accelerating from rest to a velocity of 6 m/s. The change in time is the time it takes the bicycle to travel 50 m.

We can use the following equation to find the acceleration:

a = (v2 - v1) / t

where:

a is the acceleration

v2 is the final velocity (6 m/s)

v1 is the initial velocity (0 m/s)

t is the time

Plugging in the values from the problem, we get:

a = (6 m/s - 0 m/s) / 50 s

= 0.12 m/[tex]s^{2}[/tex].

Therefore, the acceleration of the bicycle is 0.12 m/[tex]s^{2}[/tex].

To know more about acceleration here

https://brainly.com/question/2303856

#SPJ3

what is volume help plz

Answers

Answer:

Explanation:

Volume = Length x width x height

Multiply the length, width and, height to get the volume of the question.

Mass can be measured with a triple
beam balance in units of
Resources
A. grams
B. Newtons
C. cubic centimeters
D. millimeters

Answers

Answer:

It can be measure by grams

If the 0.10 kg baseball on the right has a
kinetic energy of 5 J, what is its velocity?

Answers

Answer:

10 m/s

Explanation:

The kinetic energy of an object can be found by using the formula

[tex]k = \frac{1}{2} m {v}^{2} \\ [/tex]

m is the mass

v is the velocity

Since we're finding the velocity we make v the subject

That's

[tex]v = \sqrt{ \frac{2k}{m} } \\ [/tex]

From the question

k = 5 J

m = 0.1 kg

We have

[tex]v = \sqrt{ \frac{2 \times 5}{0.1} } = \sqrt{ \frac{10}{0.1} } = \sqrt{100} \\ = 10[/tex]

We have the final answer as

10 m/s

Hope this helps you

A system consisting of two particles is known to have zero total momentum. Does it follow that the kinetic energy of the system is zero as well?

Answers

Answer:

all of the particles are at rest (v = 0)

Explanation:

Therefore, since nothing is moving, the total momentum of the system must also be zero.

As a system consisting of two particles is known to have zero total momentum, the kinetic energy of the system will be zero as well.

What is momentum?

Momentum is the product of a particle's mass and velocity. Momentum is a vector quantity, which means it has a magnitude as well as a direction.

According to Isaac Newton's second law of motion, the time rate of change of momentum equals the force acting on the particle.

Momentum describes the relationship between an object's mass, velocity, and direction.

Any change in momentum generates force. As a result, a change in momentum is used to calculate the force acting on the object.

Because the total kinetic energy is zero, all of the particles are at rest (v = 0). As a result, because nothing is moving, the system's total momentum must also be zero.

Thus, the statement is true.

For more details regarding momentum, visit:

https://brainly.com/question/24030570

#SPJ2

1 If you measured the distance travelled by a snail in
inches and the time it took in minutes, what would
be the units of its speed?

Answers

The answer is m/s hope it helps


What is the frequency of a wave with a wavelength of 15 m and a wavespeed of
300 m/s?

Answers

Answer: f=20 (i think)

Explanation:

all I did was divide 300 and 15.

300/15= 20

when plate movement rocks to break its called

Answers

It is called a fault

A new moon is discovered orbiting Neptune with an orbital speed of 9.3 x103 m/s. Neptune's mass is 1.0 x1026 kg. A) What is the radius of the new moon's orbit? B) What is the orbital period? Assume that the orbit is circular. (G = 6.673 x10-11 N-m²/kg?​

Answers

The radius of the new moons orbit is R= 7.715 x 10^7 m
The orbital period of the moon is T= 14.48 hr

A 50.0 kg crate is pulled 375 N of force applied to a rope. The crate slides without friction.
After being pulled 3.07 meters the crate has a velocity of 5.61 m/s. What is the angle (degrees) made by the rope with the horizontal?

Answers

Hi there!

We can use the work-energy theorem to solve.

Recall that:

[tex]\large\boxed{W = \Delta KE = \frac{1}{2}mv_f^2 - \frac{1}{2}mv_i^2}[/tex]

The initial kinetic energy is 0 J because the crate begins from rest, so we can plug in the given values for mass and final velocity:

[tex]W = \frac{1}{2}(50)(5.61^2) = 786.8025 J[/tex]

Now, we can define work:

[tex]\large\boxed{W = Fdcos\theta}}[/tex]

Now, plug in the values:

[tex]786.8025 = Fdcos\theta\\\\786.8025 = (375)(3.07)cos\theta[/tex]

Solve for theta:

[tex]cos\theta = .6834\\\theta = cos^{-1}(.6834) = \boxed{46.887^o}[/tex]

How long will it take a projectile to hit the ground if it is launched at 4.2 m/s off a 12.6 m high platform?

Answers

Answer: 3

Explanation:

I think you are supposed to divided in those problems? I'm not sure but if you aren't then please let me know. The equation I did was:

12.6 / 4.2 = 3

Hope this helps!! :)

Give proof that mass is constant and weight keeps changing.​

Answers


The mass of an object stays the same wherever it is, but its weight can change. This happens if the object goes where the gravitational field strength is different from the gravitational field strength on Earth, such as into space or another planet.

The distance between adjacent nodes in a standing wave pattern is 25.0 cm. What is the
wavelength? If the frequency is 200. Hz, what is the speed of the wave?

Answers

Answer:

Answer:

Speed of the wave in the string will be 3.2 m/sec

Explanation:

We have given frequency in the string fixed at both ends is 80 Hz

Distance between adjacent antipodes is 20 cm

We know that distance between two adjacent anti nodes is equal to half of the wavelength

So \frac{\lambda }{2}=20cm

2

λ

=20cm

\lambda =40cmλ=40cm

We have to find the speed of the wave in the string

Speed is equal to v=\lambda f=0.04\times 80=3.2m/secv=λf=0.04×80=3.2m/sec

So speed of the wave in the string will be 3.2 m/sec

A strong weightless rope has a mass, m, hanging from the middle of it. The tension force on each rope is 25 N, and the rope droops at an angle of 20.0 degrees. How much mass is hanging from the rope?​

Answers

By using Lami's theorem, Mass m = 1.75 kg approximately

Given that a strong weightless rope has a mass, m, hanging from the middle of it. If the tension force on each rope is 25 N, and the rope droops at an angle of 20.0 degrees to the horizontal.

By using Lami's theorem, we can get how much mass is hanging from the rope.

Let the angle between the rope = α = 180 - 40

α = 140 degrees

The angle between one of the rope and mass = β = 20 + 90

β = 110 degrees

The angle between the mass and the other rope = γ = 360 - (140 + 110)

γ = 360 - 250

γ = 110 degrees

W/ sinα = T/ sinβ = T/sinγ

W/ sinα = T/ sinβ

Substitute all the necessary parameters

W/sin140 = 25/sin 110

W / 0.643 = 25 / 0.939

W = 17.1 N

Weight W = mg

17.1 = 9.8m

mass m = 17.1/9.8

Mass m = 1.7455 kg

Mass m = 1.75 kg approximately

Therefore, 1.75 kg mass is hanging from the rope.

Learn more about resolution of forces here: https://brainly.com/question/1858958

What is the average speed of a car that travels 30 m in the 3 secs and 2 m 4 secs and 20 m 5 secs

Answers

Answer:

4.3333333

Explanation:

total distance / total time taken

30 + 2 + 20 / 3 + 4 + 5

52 / 12

4.3 recurring

A green ball is dropped from rest from an elevated position at the same instant that a red ball is launched horizontally (from the same height), which ball will hit the ground first? Assume the balls behave as projectiles.
a. green ball
b. red ball
c. the red and green ball will hit the ground at the same time
d. not enough information given

Answers

Answer:

c. the red and green ball will hit the ground at the same time

Explanation:

if two objects are the same size but one is heavier, the heavier one has greater density than the lighter object. Therefore, when both objects are dropped from the same height and at the same time, the heavier object should hit the ground before the lighter one.

What amount of heat is required to increase the temperature of 75. 0 grams of gold from 150°C to 250°C? The specific heat of gold is 0. 13 J/g°C. A. 750 joules B. 980 joules C. 1300 joules D. 1500 joules E. 2500 joules.

Answers

975 J of heat energy is needed to increase the temperature from 150°C to  250°C of given mass of gold.

From specific heat formula,

[tex]Q = mc \Delta T[/tex]

Where,

[tex]Q[/tex] - Heat absorbed

[tex]m[/tex] - mass of  gold = 75. 0 g

[tex]c[/tex] - specific heat of gold = 0. 13 J/g°C

[tex]\Delta T[/tex]- temperature difference =  150°C -  250°C = 100°C

Put the values in the formula,

[tex]Q = 75\times 0.13 \times 100 }\\\\Q = 975 {\rm \ J}[/tex]

Therefore, 975 J of heat energy is needed to increase the temperature of given mass of gold.

To know more about specific heat formula,

https://brainly.com/question/1209542

The heat required to increase the temperature of the gold is 980 J

The correct answer to the question is Option B. 980 J

We'll begin by calculating the change in the temperature of the gold

Initial temperature (T₁) = 150 °C Final temperature (T₂) = 250 °C Change in temperature (ΔT) =?

ΔT = T₂ – T₁

ΔT = 250 – 150

ΔT = 100 °C

Finally, we shall determine the heat required.

Mass (M) = 75 gChange in temperature (ΔT) = 100 °C Specific heat capacity (C) = 0.13 J/gºC Heat (Q) =?

Q = MCΔT

Q = 75 × 0.13 × 100

Q = 975 J

Q ≈ 980 J

The correct answer to the question is Option B. 980 J

Learn more about heat transfer:

https://brainly.com/question/10854640

Other Questions
How many electrons will one atom of element with 6 protons and 9 neutrons . give an explanation of tundra sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Is velocity ratio of a machine affected by applying oil on it?Explain with reason. rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible Complete the table to investigate dilations ofexponential functions.3.2*23x-2NAN62-12 / 0ab1d.ef241264a =bef=d =DONEIntro What are three things that all 50 state governments have in common? 18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?acuteobtuseequiangularright How do feedback mechanisms help maintain homeostasis? The pre-australopith fossils are especially significant because they challenge some of the long-standing explanations of our evolutionary history. Describe two reasons the pre-australopiths force us to rethink the savanna hypothesis in particular. (Hint: Think about the anatomical traits of the pre-australopiths and the environmental and temporal context in which they lived.) The decomposition of ammonia is: 2 NH3(g) N2(g) + 3 H2(g). If Kp is 1.5 103 at 400C, what is the partial pressure of ammonia at equilibrium when N2 is 0.20 atm and H2 is 0.15 atm? What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid? Many immigrants at the turn of the twentieth century came to the United States to escape religious persecution in their homelands. This is an example of what concept?assimilationpush-pull factorcultural shocknativism Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later How would the following triangle be classified?O scalene acuteO scalene obtuseO isosceles acuteO isosceles obtuse A rock is dropped from a height of 100 feet calculate the time between when the rock was strong and when he landed if we choose down as positive and ignore air friction the function is h(t)=16t^2-100 6(2x-11) Scenario 1:Genetic engineering can be used to create more productive strains of farm animals used for milk and meat production. By adding genes to an animals DNA, the animal can be made to be more resistant to common infections. This can reduce the need to administer large doses of antibiotics to the animals.Do you think that this type of genetic engineering should be pursued? Explain your answer. (5 points)What are some possible impacts (positive and negative) of this type of genetic engineering on individuals, society, and the environment? (5 points)Scenario 2:Mike was adopted, and his biological family history is unknown. Although he is healthy, he would like some understanding of his genetic makeup, including potential health risks and genes that he could pass on to his children. Mike has heard about commercial laboratories that can compare segments of your DNA to those of people with common hereditary diseases in order to give you some idea of how susceptible you are to the diseases. The results of these types of tests are highly inconclusive. If Mikes DNA showed that he shares similarities in a segment of DNA with people who have a given disease, his chances of developing that disease or passing it on to his children may be slightly elevated, but they are not 100 percent. These tests can cost more than $2,500 and are not covered by many insurance companies.Do you think that Mike should undergo the genetic tests? Explain your answer. (2 points)What are potential pros and cons of having such tests done? (5 points)Describe how the availability of these genetic tests might affect the frequency of genetic diseases in individuals and populations. (3 points) PLEASE HELP ASAP!!!!! So, I need to use an external mic for my phone, but the problem is that I need a "dual mic adapter". My dad gave me an "audio splitter" instead. Can I use the audio splitter instead in order to connect the external mic to my phone???